About 2-ethyl-3-oxo-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide
2-ethyl-3-oxo-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide (PubChem CID 114810112) has the molecular formula C8H14F3N3O3S
and a molecular weight of 289.28 g/mol. Its IUPAC name is 2-ethyl-3-oxo-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide.
Molecular Properties
| Compound Name | 2-ethyl-3-oxo-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide |
| PubChem CID | 114810112 |
| Molecular Formula | C8H14F3N3O3S |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-ethyl-3-oxo-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide |
| SMILES | CCC1C(=O)NCCN1S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H14F3N3O3S/c1-2-6-7(15)12-3-4-14(6)18(16,17)13-5-8(9,10)11/h6,13H,2-5H2,1H3,(H,12,15) |
| InChIKey | VRJVYEJPANDZHE-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-3-oxo-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-oxo-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide?
The IUPAC name of 2-ethyl-3-oxo-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide (CID 114810112) is 2-ethyl-3-oxo-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide.
What is the SMILES notation for 2-ethyl-3-oxo-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide?
The canonical SMILES for 2-ethyl-3-oxo-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide is CCC1C(=O)NCCN1S(=O)(=O)NCC(F)(F)F.
What is the InChIKey of 2-ethyl-3-oxo-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide?
The InChIKey is VRJVYEJPANDZHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3N3O3S/c1-2-6-7(15)12-3-4-14(6)18(16,17)13-5-8(9,10)11/h6,13H,2-5H2,1H3,(H,12,15).
What are the key properties of 2-ethyl-3-oxo-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide?
2-ethyl-3-oxo-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide has a molecular weight of 289.28 g/mol, XLogP of -0.41, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-oxo-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide is sourced from PubChem (CID 114810112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).