C11H20OSi — CID 11481014
2,3,3a,4,5,6-hexahydropentalen-1-yloxy(trimethyl)silane (PubChem CID 11481014) has the molecular formula C11H20OSi and a molecular weight of 196.37 g/mol. Its IUPAC name is 2,3,3a,4,5,6-hexahydropentalen-1-yloxy(trimethyl)silane.
| Compound Name | 2,3,3a,4,5,6-hexahydropentalen-1-yloxy(trimethyl)silane |
|---|---|
| PubChem CID | 11481014 |
| Molecular Formula | C11H20OSi |
| Molecular Weight | 196.37 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 2,3,3a,4,5,6-hexahydropentalen-1-yloxy(trimethyl)silane |
| SMILES | C[Si](C)(C)OC1=C2CCCC2CC1 |
| InChI | InChI=1S/C11H20OSi/c1-13(2,3)12-11-8-7-9-5-4-6-10(9)11/h9H,4-8H2,1-3H3 |
| InChIKey | PSRLQMVPYNSKQS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|