About 2-oxo-N-propyl-3,5-dihydro-1H-1,4-benzodiazepine-4-sulfonamide
2-oxo-N-propyl-3,5-dihydro-1H-1,4-benzodiazepine-4-sulfonamide (PubChem CID 114810171) has the molecular formula C12H17N3O3S
and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-oxo-N-propyl-3,5-dihydro-1H-1,4-benzodiazepine-4-sulfonamide.
Molecular Properties
| Compound Name | 2-oxo-N-propyl-3,5-dihydro-1H-1,4-benzodiazepine-4-sulfonamide |
| PubChem CID | 114810171 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-oxo-N-propyl-3,5-dihydro-1H-1,4-benzodiazepine-4-sulfonamide |
| SMILES | CCCNS(=O)(=O)N1CC(=O)Nc2ccccc2C1 |
| InChI | InChI=1S/C12H17N3O3S/c1-2-7-13-19(17,18)15-8-10-5-3-4-6-11(10)14-12(16)9-15/h3-6,13H,2,7-9H2,1H3,(H,14,16) |
| InChIKey | PQJLKMWJKDTARC-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-oxo-N-propyl-3,5-dihydro-1H-1,4-benzodiazepine-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-N-propyl-3,5-dihydro-1H-1,4-benzodiazepine-4-sulfonamide?
The IUPAC name of 2-oxo-N-propyl-3,5-dihydro-1H-1,4-benzodiazepine-4-sulfonamide (CID 114810171) is 2-oxo-N-propyl-3,5-dihydro-1H-1,4-benzodiazepine-4-sulfonamide.
What is the SMILES notation for 2-oxo-N-propyl-3,5-dihydro-1H-1,4-benzodiazepine-4-sulfonamide?
The canonical SMILES for 2-oxo-N-propyl-3,5-dihydro-1H-1,4-benzodiazepine-4-sulfonamide is CCCNS(=O)(=O)N1CC(=O)Nc2ccccc2C1.
What is the InChIKey of 2-oxo-N-propyl-3,5-dihydro-1H-1,4-benzodiazepine-4-sulfonamide?
The InChIKey is PQJLKMWJKDTARC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O3S/c1-2-7-13-19(17,18)15-8-10-5-3-4-6-11(10)14-12(16)9-15/h3-6,13H,2,7-9H2,1H3,(H,14,16).
What are the key properties of 2-oxo-N-propyl-3,5-dihydro-1H-1,4-benzodiazepine-4-sulfonamide?
2-oxo-N-propyl-3,5-dihydro-1H-1,4-benzodiazepine-4-sulfonamide has a molecular weight of 283.35 g/mol, XLogP of 0.69, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-N-propyl-3,5-dihydro-1H-1,4-benzodiazepine-4-sulfonamide is sourced from PubChem (CID 114810171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).