C6H9F3N4O2S — CID 114810284
4-methyl-N-(2,2,2-trifluoroethylsulfamoyl)-1H-pyrazol-5-amine (PubChem CID 114810284) has the molecular formula C6H9F3N4O2S and a molecular weight of 258.23 g/mol. Its IUPAC name is 4-methyl-N-(2,2,2-trifluoroethylsulfamoyl)-1H-pyrazol-5-amine.
| Compound Name | 4-methyl-N-(2,2,2-trifluoroethylsulfamoyl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 114810284 |
| Molecular Formula | C6H9F3N4O2S |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 4-methyl-N-(2,2,2-trifluoroethylsulfamoyl)-1H-pyrazol-5-amine |
| SMILES | Cc1cn[nH]c1NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H9F3N4O2S/c1-4-2-10-12-5(4)13-16(14,15)11-3-6(7,8)9/h2,11H,3H2,1H3,(H2,10,12,13) |
| InChIKey | GXKHAMSEYVQCIK-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |