About 3-ethoxy-N-(methylsulfamoyl)-1H-1,2,4-triazol-5-amine
3-ethoxy-N-(methylsulfamoyl)-1H-1,2,4-triazol-5-amine (PubChem CID 114810298) has the molecular formula C5H11N5O3S
and a molecular weight of 221.24 g/mol. Its IUPAC name is 3-ethoxy-N-(methylsulfamoyl)-1H-1,2,4-triazol-5-amine.
Molecular Properties
| Compound Name | 3-ethoxy-N-(methylsulfamoyl)-1H-1,2,4-triazol-5-amine |
| PubChem CID | 114810298 |
| Molecular Formula | C5H11N5O3S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 3-ethoxy-N-(methylsulfamoyl)-1H-1,2,4-triazol-5-amine |
| SMILES | CCOc1n[nH]c(NS(=O)(=O)NC)n1 |
| InChI | InChI=1S/C5H11N5O3S/c1-3-13-5-7-4(8-9-5)10-14(11,12)6-2/h6H,3H2,1-2H3,(H2,7,8,9,10) |
| InChIKey | ICYZFGAZTQDPHH-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-ethoxy-N-(methylsulfamoyl)-1H-1,2,4-triazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-N-(methylsulfamoyl)-1H-1,2,4-triazol-5-amine?
The IUPAC name of 3-ethoxy-N-(methylsulfamoyl)-1H-1,2,4-triazol-5-amine (CID 114810298) is 3-ethoxy-N-(methylsulfamoyl)-1H-1,2,4-triazol-5-amine.
What is the SMILES notation for 3-ethoxy-N-(methylsulfamoyl)-1H-1,2,4-triazol-5-amine?
The canonical SMILES for 3-ethoxy-N-(methylsulfamoyl)-1H-1,2,4-triazol-5-amine is CCOc1n[nH]c(NS(=O)(=O)NC)n1.
What is the InChIKey of 3-ethoxy-N-(methylsulfamoyl)-1H-1,2,4-triazol-5-amine?
The InChIKey is ICYZFGAZTQDPHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N5O3S/c1-3-13-5-7-4(8-9-5)10-14(11,12)6-2/h6H,3H2,1-2H3,(H2,7,8,9,10).
What are the key properties of 3-ethoxy-N-(methylsulfamoyl)-1H-1,2,4-triazol-5-amine?
3-ethoxy-N-(methylsulfamoyl)-1H-1,2,4-triazol-5-amine has a molecular weight of 221.24 g/mol, XLogP of -0.92, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-N-(methylsulfamoyl)-1H-1,2,4-triazol-5-amine is sourced from PubChem (CID 114810298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).