C9H16F3N3O2S — CID 114810360
2-methyl-N-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-sulfonamide (PubChem CID 114810360) has the molecular formula C9H16F3N3O2S and a molecular weight of 287.31 g/mol. Its IUPAC name is 2-methyl-N-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-sulfonamide.
| Compound Name | 2-methyl-N-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-sulfonamide |
|---|---|
| PubChem CID | 114810360 |
| Molecular Formula | C9H16F3N3O2S |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-methyl-N-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-sulfonamide |
| SMILES | CC1CC2CNCC2N1S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H16F3N3O2S/c1-6-2-7-3-13-4-8(7)15(6)18(16,17)14-5-9(10,11)12/h6-8,13-14H,2-5H2,1H3 |
| InChIKey | QWHGDHXOWIDFHA-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |