About (5R)-3,6-dimethoxy-2-methyl-5-propan-2-yl-2,5-dihydropyrazine
(5R)-3,6-dimethoxy-2-methyl-5-propan-2-yl-2,5-dihydropyrazine (PubChem CID 11481040) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is (5R)-3,6-dimethoxy-2-methyl-5-propan-2-yl-2,5-dihydropyrazine.
Molecular Properties
| Compound Name | (5R)-3,6-dimethoxy-2-methyl-5-propan-2-yl-2,5-dihydropyrazine |
| PubChem CID | 11481040 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (5R)-3,6-dimethoxy-2-methyl-5-propan-2-yl-2,5-dihydropyrazine |
| SMILES | COC1=N[C@H](C(C)C)C(OC)=NC1C |
| InChI | InChI=1S/C10H18N2O2/c1-6(2)8-10(14-5)11-7(3)9(12-8)13-4/h6-8H,1-5H3/t7?,8-/m1/s1 |
| InChIKey | AGSVBAIKOLJRNR-BRFYHDHCSA-N |
| XLogP | 1.50 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5R)-3,6-dimethoxy-2-methyl-5-propan-2-yl-2,5-dihydropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-3,6-dimethoxy-2-methyl-5-propan-2-yl-2,5-dihydropyrazine?
The IUPAC name of (5R)-3,6-dimethoxy-2-methyl-5-propan-2-yl-2,5-dihydropyrazine (CID 11481040) is (5R)-3,6-dimethoxy-2-methyl-5-propan-2-yl-2,5-dihydropyrazine.
What is the SMILES notation for (5R)-3,6-dimethoxy-2-methyl-5-propan-2-yl-2,5-dihydropyrazine?
The canonical SMILES for (5R)-3,6-dimethoxy-2-methyl-5-propan-2-yl-2,5-dihydropyrazine is COC1=N[C@H](C(C)C)C(OC)=NC1C.
What is the InChIKey of (5R)-3,6-dimethoxy-2-methyl-5-propan-2-yl-2,5-dihydropyrazine?
The InChIKey is AGSVBAIKOLJRNR-BRFYHDHCSA-N. The full InChI is InChI=1S/C10H18N2O2/c1-6(2)8-10(14-5)11-7(3)9(12-8)13-4/h6-8H,1-5H3/t7?,8-/m1/s1.
What are the key properties of (5R)-3,6-dimethoxy-2-methyl-5-propan-2-yl-2,5-dihydropyrazine?
(5R)-3,6-dimethoxy-2-methyl-5-propan-2-yl-2,5-dihydropyrazine has a molecular weight of 198.27 g/mol, XLogP of 1.50, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-3,6-dimethoxy-2-methyl-5-propan-2-yl-2,5-dihydropyrazine is sourced from PubChem (CID 11481040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).