About 4-[5-(aminomethyl)thiophen-2-yl]-N-(cyclopropylsulfamoyl)-5-methyl-1,3-thiazol-2-amine
4-[5-(aminomethyl)thiophen-2-yl]-N-(cyclopropylsulfamoyl)-5-methyl-1,3-thiazol-2-amine (PubChem CID 114810448) has the molecular formula C12H16N4O2S3
and a molecular weight of 344.49 g/mol. Its IUPAC name is 4-[5-(aminomethyl)thiophen-2-yl]-N-(cyclopropylsulfamoyl)-5-methyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-[5-(aminomethyl)thiophen-2-yl]-N-(cyclopropylsulfamoyl)-5-methyl-1,3-thiazol-2-amine |
| PubChem CID | 114810448 |
| Molecular Formula | C12H16N4O2S3 |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 4-[5-(aminomethyl)thiophen-2-yl]-N-(cyclopropylsulfamoyl)-5-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1sc(NS(=O)(=O)NC2CC2)nc1-c1ccc(CN)s1 |
| InChI | InChI=1S/C12H16N4O2S3/c1-7-11(10-5-4-9(6-13)20-10)14-12(19-7)16-21(17,18)15-8-2-3-8/h4-5,8,15H,2-3,6,13H2,1H3,(H,14,16) |
| InChIKey | NBUDMAWXAMTYAJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[5-(aminomethyl)thiophen-2-yl]-N-(cyclopropylsulfamoyl)-5-methyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(aminomethyl)thiophen-2-yl]-N-(cyclopropylsulfamoyl)-5-methyl-1,3-thiazol-2-amine?
The IUPAC name of 4-[5-(aminomethyl)thiophen-2-yl]-N-(cyclopropylsulfamoyl)-5-methyl-1,3-thiazol-2-amine (CID 114810448) is 4-[5-(aminomethyl)thiophen-2-yl]-N-(cyclopropylsulfamoyl)-5-methyl-1,3-thiazol-2-amine.
What is the SMILES notation for 4-[5-(aminomethyl)thiophen-2-yl]-N-(cyclopropylsulfamoyl)-5-methyl-1,3-thiazol-2-amine?
The canonical SMILES for 4-[5-(aminomethyl)thiophen-2-yl]-N-(cyclopropylsulfamoyl)-5-methyl-1,3-thiazol-2-amine is Cc1sc(NS(=O)(=O)NC2CC2)nc1-c1ccc(CN)s1.
What is the InChIKey of 4-[5-(aminomethyl)thiophen-2-yl]-N-(cyclopropylsulfamoyl)-5-methyl-1,3-thiazol-2-amine?
The InChIKey is NBUDMAWXAMTYAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O2S3/c1-7-11(10-5-4-9(6-13)20-10)14-12(19-7)16-21(17,18)15-8-2-3-8/h4-5,8,15H,2-3,6,13H2,1H3,(H,14,16).
What are the key properties of 4-[5-(aminomethyl)thiophen-2-yl]-N-(cyclopropylsulfamoyl)-5-methyl-1,3-thiazol-2-amine?
4-[5-(aminomethyl)thiophen-2-yl]-N-(cyclopropylsulfamoyl)-5-methyl-1,3-thiazol-2-amine has a molecular weight of 344.49 g/mol, XLogP of 2.05, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(aminomethyl)thiophen-2-yl]-N-(cyclopropylsulfamoyl)-5-methyl-1,3-thiazol-2-amine is sourced from PubChem (CID 114810448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).