C10H18F3N3O2S — CID 114811060
4,4-dimethyl-N-(2,2,2-trifluoroethyl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-sulfonamide (PubChem CID 114811060) has the molecular formula C10H18F3N3O2S and a molecular weight of 301.33 g/mol. Its IUPAC name is 4,4-dimethyl-N-(2,2,2-trifluoroethyl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-sulfonamide.
| Compound Name | 4,4-dimethyl-N-(2,2,2-trifluoroethyl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-sulfonamide |
|---|---|
| PubChem CID | 114811060 |
| Molecular Formula | C10H18F3N3O2S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 4,4-dimethyl-N-(2,2,2-trifluoroethyl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-sulfonamide |
| SMILES | CC1(C)C2CNCC2CN1S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H18F3N3O2S/c1-9(2)8-4-14-3-7(8)5-16(9)19(17,18)15-6-10(11,12)13/h7-8,14-15H,3-6H2,1-2H3 |
| InChIKey | GGQRUCPUAXWYHN-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |