C9H21N3O2S — CID 114811253
2-cyclopropyl-2-N-(propan-2-ylsulfamoyl)propane-1,2-diamine (PubChem CID 114811253) has the molecular formula C9H21N3O2S and a molecular weight of 235.35 g/mol. Its IUPAC name is 2-cyclopropyl-2-N-(propan-2-ylsulfamoyl)propane-1,2-diamine.
| Compound Name | 2-cyclopropyl-2-N-(propan-2-ylsulfamoyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 114811253 |
| Molecular Formula | C9H21N3O2S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2-cyclopropyl-2-N-(propan-2-ylsulfamoyl)propane-1,2-diamine |
| SMILES | CC(C)NS(=O)(=O)NC(C)(CN)C1CC1 |
| InChI | InChI=1S/C9H21N3O2S/c1-7(2)11-15(13,14)12-9(3,6-10)8-4-5-8/h7-8,11-12H,4-6,10H2,1-3H3 |
| InChIKey | LAVLGZATXBDYBZ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |