C14H20O — CID 11481130
(1aS,4aR,8aR)-4a,8,8-trimethyl-1a,5,6,7-tetrahydro-1H-cyclopropa[j]naphthalen-2-one (PubChem CID 11481130) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is (1aS,4aR,8aR)-4a,8,8-trimethyl-1a,5,6,7-tetrahydro-1H-cyclopropa[j]naphthalen-2-one.
| Compound Name | (1aS,4aR,8aR)-4a,8,8-trimethyl-1a,5,6,7-tetrahydro-1H-cyclopropa[j]naphthalen-2-one |
|---|---|
| PubChem CID | 11481130 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (1aS,4aR,8aR)-4a,8,8-trimethyl-1a,5,6,7-tetrahydro-1H-cyclopropa[j]naphthalen-2-one |
| SMILES | CC1(C)CCC[C@]2(C)C=CC(=O)[C@H]3C[C@@]312 |
| InChI | InChI=1S/C14H20O/c1-12(2)6-4-7-13(3)8-5-11(15)10-9-14(10,12)13/h5,8,10H,4,6-7,9H2,1-3H3/t10-,13-,14-/m1/s1 |
| InChIKey | MPIBOQKDJNGGSK-LERXQTSPSA-N |
| XLogP | 3.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |