C6H12F3N3O2S — CID 114811344
(E)-N'-(2,2,2-trifluoroethylsulfamoyl)but-2-ene-1,4-diamine (PubChem CID 114811344) has the molecular formula C6H12F3N3O2S and a molecular weight of 247.24 g/mol. Its IUPAC name is (E)-N'-(2,2,2-trifluoroethylsulfamoyl)but-2-ene-1,4-diamine.
| Compound Name | (E)-N'-(2,2,2-trifluoroethylsulfamoyl)but-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 114811344 |
| Molecular Formula | C6H12F3N3O2S |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | (E)-N'-(2,2,2-trifluoroethylsulfamoyl)but-2-ene-1,4-diamine |
| SMILES | NC/C=C/CNS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H12F3N3O2S/c7-6(8,9)5-12-15(13,14)11-4-2-1-3-10/h1-2,11-12H,3-5,10H2/b2-1+ |
| InChIKey | UQLRLTUMIGJXKM-OWOJBTEDSA-N |
| XLogP | -0.51 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|