About methyl 2-[propan-2-yl(2,2,2-trifluoroethylsulfamoyl)amino]acetate
methyl 2-[propan-2-yl(2,2,2-trifluoroethylsulfamoyl)amino]acetate (PubChem CID 114811552) has the molecular formula C8H15F3N2O4S
and a molecular weight of 292.28 g/mol. Its IUPAC name is methyl 2-[propan-2-yl(2,2,2-trifluoroethylsulfamoyl)amino]acetate.
Molecular Properties
| Compound Name | methyl 2-[propan-2-yl(2,2,2-trifluoroethylsulfamoyl)amino]acetate |
| PubChem CID | 114811552 |
| Molecular Formula | C8H15F3N2O4S |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | methyl 2-[propan-2-yl(2,2,2-trifluoroethylsulfamoyl)amino]acetate |
| SMILES | COC(=O)CN(C(C)C)S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H15F3N2O4S/c1-6(2)13(4-7(14)17-3)18(15,16)12-5-8(9,10)11/h6,12H,4-5H2,1-3H3 |
| InChIKey | NXMNUIRZFZXCEG-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[propan-2-yl(2,2,2-trifluoroethylsulfamoyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[propan-2-yl(2,2,2-trifluoroethylsulfamoyl)amino]acetate?
The IUPAC name of methyl 2-[propan-2-yl(2,2,2-trifluoroethylsulfamoyl)amino]acetate (CID 114811552) is methyl 2-[propan-2-yl(2,2,2-trifluoroethylsulfamoyl)amino]acetate.
What is the SMILES notation for methyl 2-[propan-2-yl(2,2,2-trifluoroethylsulfamoyl)amino]acetate?
The canonical SMILES for methyl 2-[propan-2-yl(2,2,2-trifluoroethylsulfamoyl)amino]acetate is COC(=O)CN(C(C)C)S(=O)(=O)NCC(F)(F)F.
What is the InChIKey of methyl 2-[propan-2-yl(2,2,2-trifluoroethylsulfamoyl)amino]acetate?
The InChIKey is NXMNUIRZFZXCEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F3N2O4S/c1-6(2)13(4-7(14)17-3)18(15,16)12-5-8(9,10)11/h6,12H,4-5H2,1-3H3.
What are the key properties of methyl 2-[propan-2-yl(2,2,2-trifluoroethylsulfamoyl)amino]acetate?
methyl 2-[propan-2-yl(2,2,2-trifluoroethylsulfamoyl)amino]acetate has a molecular weight of 292.28 g/mol, XLogP of 0.27, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[propan-2-yl(2,2,2-trifluoroethylsulfamoyl)amino]acetate is sourced from PubChem (CID 114811552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).