C9H22O3Si — CID 11481169
2-[tert-butyl(dimethyl)silyl]oxypropane-1,3-diol (PubChem CID 11481169) has the molecular formula C9H22O3Si and a molecular weight of 206.36 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxypropane-1,3-diol.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxypropane-1,3-diol |
|---|---|
| PubChem CID | 11481169 |
| Molecular Formula | C9H22O3Si |
| Molecular Weight | 206.36 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxypropane-1,3-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC(CO)CO |
| InChI | InChI=1S/C9H22O3Si/c1-9(2,3)13(4,5)12-8(6-10)7-11/h8,10-11H,6-7H2,1-5H3 |
| InChIKey | MRDHLKVAYGFKCI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|