C14H21N3O2S — CID 114812083
5-(3-aminoprop-1-ynyl)-N-(tert-butylsulfamoyl)-2-methylaniline (PubChem CID 114812083) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 5-(3-aminoprop-1-ynyl)-N-(tert-butylsulfamoyl)-2-methylaniline.
| Compound Name | 5-(3-aminoprop-1-ynyl)-N-(tert-butylsulfamoyl)-2-methylaniline |
|---|---|
| PubChem CID | 114812083 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 5-(3-aminoprop-1-ynyl)-N-(tert-butylsulfamoyl)-2-methylaniline |
| SMILES | Cc1ccc(C#CCN)cc1NS(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H21N3O2S/c1-11-7-8-12(6-5-9-15)10-13(11)16-20(18,19)17-14(2,3)4/h7-8,10,16-17H,9,15H2,1-4H3 |
| InChIKey | WBFVLTWFDJSMOS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|