C10H12F3N3O2S2 — CID 114812180
3-[5-[(2,2,2-trifluoroethylsulfamoylamino)methyl]thiophen-3-yl]prop-2-yn-1-amine (PubChem CID 114812180) has the molecular formula C10H12F3N3O2S2 and a molecular weight of 327.35 g/mol. Its IUPAC name is 3-[5-[(2,2,2-trifluoroethylsulfamoylamino)methyl]thiophen-3-yl]prop-2-yn-1-amine.
| Compound Name | 3-[5-[(2,2,2-trifluoroethylsulfamoylamino)methyl]thiophen-3-yl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 114812180 |
| Molecular Formula | C10H12F3N3O2S2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 3-[5-[(2,2,2-trifluoroethylsulfamoylamino)methyl]thiophen-3-yl]prop-2-yn-1-amine |
| SMILES | NCC#Cc1csc(CNS(=O)(=O)NCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H12F3N3O2S2/c11-10(12,13)7-16-20(17,18)15-5-9-4-8(6-19-9)2-1-3-14/h4,6,15-16H,3,5,7,14H2 |
| InChIKey | HXXMTAQTDZAUHP-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|