C11H14O2S — CID 11481241
(2R,4S,5R)-5-methyl-2-phenyl-1,4-oxathiane 4-oxide (PubChem CID 11481241) has the molecular formula C11H14O2S and a molecular weight of 210.30 g/mol. Its IUPAC name is (2R,4S,5R)-5-methyl-2-phenyl-1,4-oxathiane 4-oxide.
| Compound Name | (2R,4S,5R)-5-methyl-2-phenyl-1,4-oxathiane 4-oxide |
|---|---|
| PubChem CID | 11481241 |
| Molecular Formula | C11H14O2S |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | (2R,4S,5R)-5-methyl-2-phenyl-1,4-oxathiane 4-oxide |
| SMILES | C[C@@H]1CO[C@H](c2ccccc2)C[S@@]1=O |
| InChI | InChI=1S/C11H14O2S/c1-9-7-13-11(8-14(9)12)10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3/t9-,11+,14+/m1/s1 |
| InChIKey | ORLMHBCLSNTNSY-PUYPPJJSSA-N |
| XLogP | 1.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |