C10H11F3N2O4S2 — CID 114812720
(E)-3-[5-[(2,2,2-trifluoroethylsulfamoylamino)methyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 114812720) has the molecular formula C10H11F3N2O4S2 and a molecular weight of 344.34 g/mol. Its IUPAC name is (E)-3-[5-[(2,2,2-trifluoroethylsulfamoylamino)methyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[(2,2,2-trifluoroethylsulfamoylamino)methyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 114812720 |
| Molecular Formula | C10H11F3N2O4S2 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | (E)-3-[5-[(2,2,2-trifluoroethylsulfamoylamino)methyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1csc(CNS(=O)(=O)NCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H11F3N2O4S2/c11-10(12,13)6-15-21(18,19)14-4-8-3-7(5-20-8)1-2-9(16)17/h1-3,5,14-15H,4,6H2,(H,16,17)/b2-1+ |
| InChIKey | MZLXYWXCTPSQOR-OWOJBTEDSA-N |
| XLogP | 1.33 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|