C7F6O — CID 11481299
2,3,4,5,6,7-hexafluorocyclohepta-2,4,6-trien-1-one (PubChem CID 11481299) has the molecular formula C7F6O and a molecular weight of 214.06 g/mol. Its IUPAC name is 2,3,4,5,6,7-hexafluorocyclohepta-2,4,6-trien-1-one.
| Compound Name | 2,3,4,5,6,7-hexafluorocyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 11481299 |
| Molecular Formula | C7F6O |
| Molecular Weight | 214.06 g/mol |
| Exact Mass | 213.99 |
| IUPAC Name | 2,3,4,5,6,7-hexafluorocyclohepta-2,4,6-trien-1-one |
| SMILES | O=c1c(F)c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C7F6O/c8-1-2(9)4(11)6(13)7(14)5(12)3(1)10 |
| InChIKey | HQWDEMBCYQRECB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.06 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |