C11H22F3N3O3S — CID 114813135
2-[(2-methoxyethylamino)methyl]-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide (PubChem CID 114813135) has the molecular formula C11H22F3N3O3S and a molecular weight of 333.38 g/mol. Its IUPAC name is 2-[(2-methoxyethylamino)methyl]-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide.
| Compound Name | 2-[(2-methoxyethylamino)methyl]-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 114813135 |
| Molecular Formula | C11H22F3N3O3S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-[(2-methoxyethylamino)methyl]-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide |
| SMILES | COCCNCC1CCCCN1S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C11H22F3N3O3S/c1-20-7-5-15-8-10-4-2-3-6-17(10)21(18,19)16-9-11(12,13)14/h10,15-16H,2-9H2,1H3 |
| InChIKey | JSIXANFBHTWDRB-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|