C10H20F3N5O2S — CID 114813236
2-methyl-2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]propanimidamide (PubChem CID 114813236) has the molecular formula C10H20F3N5O2S and a molecular weight of 331.36 g/mol. Its IUPAC name is 2-methyl-2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]propanimidamide.
| Compound Name | 2-methyl-2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]propanimidamide |
|---|---|
| PubChem CID | 114813236 |
| Molecular Formula | C10H20F3N5O2S |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 2-methyl-2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]propanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)N1CCN(S(=O)(=O)NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H20F3N5O2S/c1-9(2,8(14)15)17-3-5-18(6-4-17)21(19,20)16-7-10(11,12)13/h16H,3-7H2,1-2H3,(H3,14,15) |
| InChIKey | CLMNXJFHDAVWBB-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|