C6H14N4O2S — CID 114813259
2-[cyclopropylsulfamoyl(methyl)amino]ethanimidamide (PubChem CID 114813259) has the molecular formula C6H14N4O2S and a molecular weight of 206.27 g/mol. Its IUPAC name is 2-[cyclopropylsulfamoyl(methyl)amino]ethanimidamide.
| Compound Name | 2-[cyclopropylsulfamoyl(methyl)amino]ethanimidamide |
|---|---|
| PubChem CID | 114813259 |
| Molecular Formula | C6H14N4O2S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 2-[cyclopropylsulfamoyl(methyl)amino]ethanimidamide |
| SMILES | [H]/N=C(\N)CN(C)S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C6H14N4O2S/c1-10(4-6(7)8)13(11,12)9-5-2-3-5/h5,9H,2-4H2,1H3,(H3,7,8) |
| InChIKey | RNIQAVRAPAPMLB-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|