About 2-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide
2-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide (PubChem CID 114813424) has the molecular formula C6H13F3N4O2S
and a molecular weight of 262.26 g/mol. Its IUPAC name is 2-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide.
Molecular Properties
| Compound Name | 2-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide |
| PubChem CID | 114813424 |
| Molecular Formula | C6H13F3N4O2S |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 2-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide |
| SMILES | [H]/N=C(\N)C(C)N(C)S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H13F3N4O2S/c1-4(5(10)11)13(2)16(14,15)12-3-6(7,8)9/h4,12H,3H2,1-2H3,(H3,10,11) |
| InChIKey | QTYWUUCKYRENFZ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide?
The IUPAC name of 2-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide (CID 114813424) is 2-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide.
What is the SMILES notation for 2-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide?
The canonical SMILES for 2-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide is [H]/N=C(\N)C(C)N(C)S(=O)(=O)NCC(F)(F)F.
What is the InChIKey of 2-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide?
The InChIKey is QTYWUUCKYRENFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13F3N4O2S/c1-4(5(10)11)13(2)16(14,15)12-3-6(7,8)9/h4,12H,3H2,1-2H3,(H3,10,11).
What are the key properties of 2-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide?
2-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide has a molecular weight of 262.26 g/mol, XLogP of -0.36, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide is sourced from PubChem (CID 114813424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).