C8H15F3N4O2S — CID 114813474
3-[cyclopropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide (PubChem CID 114813474) has the molecular formula C8H15F3N4O2S and a molecular weight of 288.30 g/mol. Its IUPAC name is 3-[cyclopropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide.
| Compound Name | 3-[cyclopropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide |
|---|---|
| PubChem CID | 114813474 |
| Molecular Formula | C8H15F3N4O2S |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 3-[cyclopropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide |
| SMILES | [H]/N=C(\N)CCN(C1CC1)S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H15F3N4O2S/c9-8(10,11)5-14-18(16,17)15(6-1-2-6)4-3-7(12)13/h6,14H,1-5H2,(H3,12,13) |
| InChIKey | XXQOZLBKUZUMDI-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|