C8H20N4O2S — CID 114813612
2,2-dimethyl-3-(propan-2-ylsulfamoylamino)propanimidamide (PubChem CID 114813612) has the molecular formula C8H20N4O2S and a molecular weight of 236.34 g/mol. Its IUPAC name is 2,2-dimethyl-3-(propan-2-ylsulfamoylamino)propanimidamide.
| Compound Name | 2,2-dimethyl-3-(propan-2-ylsulfamoylamino)propanimidamide |
|---|---|
| PubChem CID | 114813612 |
| Molecular Formula | C8H20N4O2S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2,2-dimethyl-3-(propan-2-ylsulfamoylamino)propanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CNS(=O)(=O)NC(C)C |
| InChI | InChI=1S/C8H20N4O2S/c1-6(2)12-15(13,14)11-5-8(3,4)7(9)10/h6,11-12H,5H2,1-4H3,(H3,9,10) |
| InChIKey | NNXKMKDQIFOILF-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|