C8H12ClN3O2S — CID 114813663
4-chloro-N-(propylsulfamoyl)pyridin-2-amine (PubChem CID 114813663) has the molecular formula C8H12ClN3O2S and a molecular weight of 249.72 g/mol. Its IUPAC name is 4-chloro-N-(propylsulfamoyl)pyridin-2-amine.
| Compound Name | 4-chloro-N-(propylsulfamoyl)pyridin-2-amine |
|---|---|
| PubChem CID | 114813663 |
| Molecular Formula | C8H12ClN3O2S |
| Molecular Weight | 249.72 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 4-chloro-N-(propylsulfamoyl)pyridin-2-amine |
| SMILES | CCCNS(=O)(=O)Nc1cc(Cl)ccn1 |
| InChI | InChI=1S/C8H12ClN3O2S/c1-2-4-11-15(13,14)12-8-6-7(9)3-5-10-8/h3,5-6,11H,2,4H2,1H3,(H,10,12) |
| InChIKey | YXOKQAVELUUKCD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.72 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |