C10H20F3N3O2S — CID 114815039
N-(2-methylpropylsulfamoyl)-6-(trifluoromethyl)piperidin-3-amine (PubChem CID 114815039) has the molecular formula C10H20F3N3O2S and a molecular weight of 303.35 g/mol. Its IUPAC name is N-(2-methylpropylsulfamoyl)-6-(trifluoromethyl)piperidin-3-amine.
| Compound Name | N-(2-methylpropylsulfamoyl)-6-(trifluoromethyl)piperidin-3-amine |
|---|---|
| PubChem CID | 114815039 |
| Molecular Formula | C10H20F3N3O2S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-(2-methylpropylsulfamoyl)-6-(trifluoromethyl)piperidin-3-amine |
| SMILES | CC(C)CNS(=O)(=O)NC1CCC(C(F)(F)F)NC1 |
| InChI | InChI=1S/C10H20F3N3O2S/c1-7(2)5-15-19(17,18)16-8-3-4-9(14-6-8)10(11,12)13/h7-9,14-16H,3-6H2,1-2H3 |
| InChIKey | QFFUBUDEDOHFFQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |