About (2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonitrile
(2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonitrile (PubChem CID 11481506) has the molecular formula C11H20N4O
and a molecular weight of 224.31 g/mol. Its IUPAC name is (2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonitrile.
Molecular Properties
| Compound Name | (2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonitrile |
| PubChem CID | 11481506 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | (2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonitrile |
| SMILES | N#C[C@@H]1CCCN1C(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C11H20N4O/c12-6-2-1-5-10(14)11(16)15-7-3-4-9(15)8-13/h9-10H,1-7,12,14H2/t9-,10-/m0/s1 |
| InChIKey | BEXSRKUIBIGLOG-UWVGGRQHSA-N |
| XLogP | -0.04 |
| TPSA | 96.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonitrile?
The IUPAC name of (2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonitrile (CID 11481506) is (2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonitrile.
What is the SMILES notation for (2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonitrile?
The canonical SMILES for (2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonitrile is N#C[C@@H]1CCCN1C(=O)[C@@H](N)CCCCN.
What is the InChIKey of (2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonitrile?
The InChIKey is BEXSRKUIBIGLOG-UWVGGRQHSA-N. The full InChI is InChI=1S/C11H20N4O/c12-6-2-1-5-10(14)11(16)15-7-3-4-9(15)8-13/h9-10H,1-7,12,14H2/t9-,10-/m0/s1.
What are the key properties of (2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonitrile?
(2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonitrile has a molecular weight of 224.31 g/mol, XLogP of -0.04, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonitrile is sourced from PubChem (CID 11481506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).