C12H20O4 — CID 11481582
ethyl (2E)-2-[(3S,4S)-4-methoxy-3-propyloxolan-2-ylidene]acetate (PubChem CID 11481582) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is ethyl (2E)-2-[(3S,4S)-4-methoxy-3-propyloxolan-2-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[(3S,4S)-4-methoxy-3-propyloxolan-2-ylidene]acetate |
|---|---|
| PubChem CID | 11481582 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | ethyl (2E)-2-[(3S,4S)-4-methoxy-3-propyloxolan-2-ylidene]acetate |
| SMILES | CCC[C@@H]1/C(=C\C(=O)OCC)OC[C@H]1OC |
| InChI | InChI=1S/C12H20O4/c1-4-6-9-10(7-12(13)15-5-2)16-8-11(9)14-3/h7,9,11H,4-6,8H2,1-3H3/b10-7+/t9-,11-/m1/s1 |
| InChIKey | ZANCHTSABXMTGP-DHJNVWGISA-N |
| XLogP | 1.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|