About N-(2-methoxyethyl)-2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide
N-(2-methoxyethyl)-2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide (PubChem CID 114815928) has the molecular formula C9H17N3O5S
and a molecular weight of 279.32 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide.
Molecular Properties
| Compound Name | N-(2-methoxyethyl)-2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide |
| PubChem CID | 114815928 |
| Molecular Formula | C9H17N3O5S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | N-(2-methoxyethyl)-2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide |
| SMILES | COCCNS(=O)(=O)N1CC(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C9H17N3O5S/c1-9(2)8(14)11-7(13)6-12(9)18(15,16)10-4-5-17-3/h10H,4-6H2,1-3H3,(H,11,13,14) |
| InChIKey | CUOKBHBOBPDWLT-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyethyl)-2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyethyl)-2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide?
The IUPAC name of N-(2-methoxyethyl)-2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide (CID 114815928) is N-(2-methoxyethyl)-2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide.
What is the SMILES notation for N-(2-methoxyethyl)-2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide?
The canonical SMILES for N-(2-methoxyethyl)-2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide is COCCNS(=O)(=O)N1CC(=O)NC(=O)C1(C)C.
What is the InChIKey of N-(2-methoxyethyl)-2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide?
The InChIKey is CUOKBHBOBPDWLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O5S/c1-9(2)8(14)11-7(13)6-12(9)18(15,16)10-4-5-17-3/h10H,4-6H2,1-3H3,(H,11,13,14).
What are the key properties of N-(2-methoxyethyl)-2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide?
N-(2-methoxyethyl)-2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide has a molecular weight of 279.32 g/mol, XLogP of -1.80, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethyl)-2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide is sourced from PubChem (CID 114815928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).