About 3-ethoxy-2-N-(2-methoxyethylsulfamoyl)cyclobutane-1,2-diamine
3-ethoxy-2-N-(2-methoxyethylsulfamoyl)cyclobutane-1,2-diamine (PubChem CID 114816159) has the molecular formula C9H21N3O4S
and a molecular weight of 267.35 g/mol. Its IUPAC name is 3-ethoxy-2-N-(2-methoxyethylsulfamoyl)cyclobutane-1,2-diamine.
Molecular Properties
| Compound Name | 3-ethoxy-2-N-(2-methoxyethylsulfamoyl)cyclobutane-1,2-diamine |
| PubChem CID | 114816159 |
| Molecular Formula | C9H21N3O4S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 3-ethoxy-2-N-(2-methoxyethylsulfamoyl)cyclobutane-1,2-diamine |
| SMILES | CCOC1CC(N)C1NS(=O)(=O)NCCOC |
| InChI | InChI=1S/C9H21N3O4S/c1-3-16-8-6-7(10)9(8)12-17(13,14)11-4-5-15-2/h7-9,11-12H,3-6,10H2,1-2H3 |
| InChIKey | WURBGLNWDYVITJ-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxy-2-N-(2-methoxyethylsulfamoyl)cyclobutane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-2-N-(2-methoxyethylsulfamoyl)cyclobutane-1,2-diamine?
The IUPAC name of 3-ethoxy-2-N-(2-methoxyethylsulfamoyl)cyclobutane-1,2-diamine (CID 114816159) is 3-ethoxy-2-N-(2-methoxyethylsulfamoyl)cyclobutane-1,2-diamine.
What is the SMILES notation for 3-ethoxy-2-N-(2-methoxyethylsulfamoyl)cyclobutane-1,2-diamine?
The canonical SMILES for 3-ethoxy-2-N-(2-methoxyethylsulfamoyl)cyclobutane-1,2-diamine is CCOC1CC(N)C1NS(=O)(=O)NCCOC.
What is the InChIKey of 3-ethoxy-2-N-(2-methoxyethylsulfamoyl)cyclobutane-1,2-diamine?
The InChIKey is WURBGLNWDYVITJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3O4S/c1-3-16-8-6-7(10)9(8)12-17(13,14)11-4-5-15-2/h7-9,11-12H,3-6,10H2,1-2H3.
What are the key properties of 3-ethoxy-2-N-(2-methoxyethylsulfamoyl)cyclobutane-1,2-diamine?
3-ethoxy-2-N-(2-methoxyethylsulfamoyl)cyclobutane-1,2-diamine has a molecular weight of 267.35 g/mol, XLogP of -1.44, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-2-N-(2-methoxyethylsulfamoyl)cyclobutane-1,2-diamine is sourced from PubChem (CID 114816159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).