C14H22O3 — CID 11481814
(E)-4-[(4S,5S)-2,2-dimethyl-5-[(E)-pent-3-enyl]-1,3-dioxolan-4-yl]but-2-enal (PubChem CID 11481814) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is (E)-4-[(4S,5S)-2,2-dimethyl-5-[(E)-pent-3-enyl]-1,3-dioxolan-4-yl]but-2-enal.
| Compound Name | (E)-4-[(4S,5S)-2,2-dimethyl-5-[(E)-pent-3-enyl]-1,3-dioxolan-4-yl]but-2-enal |
|---|---|
| PubChem CID | 11481814 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (E)-4-[(4S,5S)-2,2-dimethyl-5-[(E)-pent-3-enyl]-1,3-dioxolan-4-yl]but-2-enal |
| SMILES | C/C=C/CC[C@@H]1OC(C)(C)O[C@H]1C/C=C/C=O |
| InChI | InChI=1S/C14H22O3/c1-4-5-6-9-12-13(10-7-8-11-15)17-14(2,3)16-12/h4-5,7-8,11-13H,6,9-10H2,1-3H3/b5-4+,8-7+/t12-,13-/m0/s1 |
| InChIKey | NIWNJBSIFBWBLR-OTHFZVLMSA-N |
| XLogP | 3.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|