About 6-phenyl-[1,3]dioxolo[4,5-f][1,3]benzoxazole
6-phenyl-[1,3]dioxolo[4,5-f][1,3]benzoxazole (PubChem CID 11481830) has the molecular formula C14H9NO3
and a molecular weight of 239.23 g/mol. Its IUPAC name is 6-phenyl-[1,3]dioxolo[4,5-f][1,3]benzoxazole.
Molecular Properties
| Compound Name | 6-phenyl-[1,3]dioxolo[4,5-f][1,3]benzoxazole |
| PubChem CID | 11481830 |
| Molecular Formula | C14H9NO3 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 6-phenyl-[1,3]dioxolo[4,5-f][1,3]benzoxazole |
| SMILES | c1ccc(-c2nc3cc4c(cc3o2)OCO4)cc1 |
| InChI | InChI=1S/C14H9NO3/c1-2-4-9(5-3-1)14-15-10-6-12-13(17-8-16-12)7-11(10)18-14/h1-7H,8H2 |
| InChIKey | VAZKZHDGYXWIKL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-phenyl-[1,3]dioxolo[4,5-f][1,3]benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyl-[1,3]dioxolo[4,5-f][1,3]benzoxazole?
The IUPAC name of 6-phenyl-[1,3]dioxolo[4,5-f][1,3]benzoxazole (CID 11481830) is 6-phenyl-[1,3]dioxolo[4,5-f][1,3]benzoxazole.
What is the SMILES notation for 6-phenyl-[1,3]dioxolo[4,5-f][1,3]benzoxazole?
The canonical SMILES for 6-phenyl-[1,3]dioxolo[4,5-f][1,3]benzoxazole is c1ccc(-c2nc3cc4c(cc3o2)OCO4)cc1.
What is the InChIKey of 6-phenyl-[1,3]dioxolo[4,5-f][1,3]benzoxazole?
The InChIKey is VAZKZHDGYXWIKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO3/c1-2-4-9(5-3-1)14-15-10-6-12-13(17-8-16-12)7-11(10)18-14/h1-7H,8H2.
What are the key properties of 6-phenyl-[1,3]dioxolo[4,5-f][1,3]benzoxazole?
6-phenyl-[1,3]dioxolo[4,5-f][1,3]benzoxazole has a molecular weight of 239.23 g/mol, XLogP of 3.22, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyl-[1,3]dioxolo[4,5-f][1,3]benzoxazole is sourced from PubChem (CID 11481830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).