C18H22N2S — CID 114818597
4-(spiro[5,7-dihydro-4H-1,3-benzothiazole-6,1'-cyclopentane]-2-ylmethyl)aniline (PubChem CID 114818597) has the molecular formula C18H22N2S and a molecular weight of 298.45 g/mol. Its IUPAC name is 4-(spiro[5,7-dihydro-4H-1,3-benzothiazole-6,1'-cyclopentane]-2-ylmethyl)aniline.
| Compound Name | 4-(spiro[5,7-dihydro-4H-1,3-benzothiazole-6,1'-cyclopentane]-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 114818597 |
| Molecular Formula | C18H22N2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 4-(spiro[5,7-dihydro-4H-1,3-benzothiazole-6,1'-cyclopentane]-2-ylmethyl)aniline |
| SMILES | Nc1ccc(Cc2nc3c(s2)CC2(CCCC2)CC3)cc1 |
| InChI | InChI=1S/C18H22N2S/c19-14-5-3-13(4-6-14)11-17-20-15-7-10-18(8-1-2-9-18)12-16(15)21-17/h3-6H,1-2,7-12,19H2 |
| InChIKey | MYINEJDFTYVPMB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|