C15H21NO4 — CID 114818940
2-[1-[[(5-methylfuran-3-carbonyl)amino]methyl]cyclohexyl]acetic acid (PubChem CID 114818940) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-[1-[[(5-methylfuran-3-carbonyl)amino]methyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[[(5-methylfuran-3-carbonyl)amino]methyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 114818940 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-[1-[[(5-methylfuran-3-carbonyl)amino]methyl]cyclohexyl]acetic acid |
| SMILES | Cc1cc(C(=O)NCC2(CC(=O)O)CCCCC2)co1 |
| InChI | InChI=1S/C15H21NO4/c1-11-7-12(9-20-11)14(19)16-10-15(8-13(17)18)5-3-2-4-6-15/h7,9H,2-6,8,10H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | AKFKRDDFJVTGTM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |