C13H22O4 — CID 11481904
(1R,3S,3aS,7R,7aR)-1,3-dimethoxy-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-2-benzofuran-4-one (PubChem CID 11481904) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (1R,3S,3aS,7R,7aR)-1,3-dimethoxy-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-2-benzofuran-4-one.
| Compound Name | (1R,3S,3aS,7R,7aR)-1,3-dimethoxy-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-2-benzofuran-4-one |
|---|---|
| PubChem CID | 11481904 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (1R,3S,3aS,7R,7aR)-1,3-dimethoxy-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-2-benzofuran-4-one |
| SMILES | CO[C@H]1O[C@@H](OC)[C@H]2[C@@H]1C(=O)CC[C@@H]2C(C)C |
| InChI | InChI=1S/C13H22O4/c1-7(2)8-5-6-9(14)11-10(8)12(15-3)17-13(11)16-4/h7-8,10-13H,5-6H2,1-4H3/t8-,10-,11+,12-,13+/m1/s1 |
| InChIKey | VSVNPOSOQXXWKY-ZMHPAJMFSA-N |
| XLogP | 1.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |