8-morpholin-4-ylspiro[4.5]decane-8-carboxylic acid

C15H25NO3 — CID 114819765

IUPAC8-morpholin-4-ylspiro[4.5]decane-8-carboxylic acid
SMILESO=C(O)C1(N2CCOCC2)CCC2(CCCC2)CC1
InChIInChI=1S/C15H25NO3/c17-13(18)15(16-9-11-19-12-10-16)7-5-14(6-8-15)3-1-2-4-14/h1-12H2,(H,17,18)
InChIKeyLONXYBWFVLMQQD-UHFFFAOYSA-N
MW267.37 g/mol
LogP2.28
Rot. Bonds2

About 8-morpholin-4-ylspiro[4.5]decane-8-carboxylic acid

8-morpholin-4-ylspiro[4.5]decane-8-carboxylic acid (PubChem CID 114819765) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 8-morpholin-4-ylspiro[4.5]decane-8-carboxylic acid.

Molecular Properties

Compound Name8-morpholin-4-ylspiro[4.5]decane-8-carboxylic acid
PubChem CID114819765
Molecular FormulaC15H25NO3
Molecular Weight267.37 g/mol
Exact Mass267.18
IUPAC Name8-morpholin-4-ylspiro[4.5]decane-8-carboxylic acid
SMILESO=C(O)C1(N2CCOCC2)CCC2(CCCC2)CC1
InChIInChI=1S/C15H25NO3/c17-13(18)15(16-9-11-19-12-10-16)7-5-14(6-8-15)3-1-2-4-14/h1-12H2,(H,17,18)
InChIKeyLONXYBWFVLMQQD-UHFFFAOYSA-N
XLogP2.28
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.37
LogP ≤ 52.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 8-morpholin-4-ylspiro[4.5]decane-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

1-morpholin-4-ylcyclohexane-1-carboxylic acid;hydrochloride
CID 66545433
4-morpholin-4-ylthiane-4-carboxylic acid
CID 61339323
1-(7-oxa-2-azaspiro[3.5]nonan-2-yl)cyclopropane-1-carboxylic acid
CID 79694296
3-methyl-1-morpholin-4-ylcyclohexane-1-carboxylic acid
CID 43803240
1-(1,1-dioxo-1,4-thiazinan-4-yl)cyclohexane-1-carboxylic acid
CID 61291228
4-(4-methyl-1,4-diazepan-1-yl)oxane-4-carboxylic acid
CID 114991651
2,2-dimethyl-1-(1-morpholin-4-ylcyclopentyl)propan-1-one
CID 79057514
methyl 1-morpholin-4-ylcyclopentane-1-carboxylate
CID 67506200
3,4-dimethyl-1-morpholin-4-ylcyclohexane-1-carboxylic acid
CID 64745091
3-(azetidin-1-yl)oxolane-3-carboxylic acid
CID 84765930
(1-morpholin-4-ylcyclopentyl)-(oxan-4-yl)methanone
CID 79059005
1-(2-azaspiro[3.3]heptan-2-yl)cycloheptane-1-carboxylic acid
CID 79694328

Frequently Asked Questions

What is the IUPAC name of 8-morpholin-4-ylspiro[4.5]decane-8-carboxylic acid?
The IUPAC name of 8-morpholin-4-ylspiro[4.5]decane-8-carboxylic acid (CID 114819765) is 8-morpholin-4-ylspiro[4.5]decane-8-carboxylic acid.
What is the SMILES notation for 8-morpholin-4-ylspiro[4.5]decane-8-carboxylic acid?
The canonical SMILES for 8-morpholin-4-ylspiro[4.5]decane-8-carboxylic acid is O=C(O)C1(N2CCOCC2)CCC2(CCCC2)CC1.
What is the InChIKey of 8-morpholin-4-ylspiro[4.5]decane-8-carboxylic acid?
The InChIKey is LONXYBWFVLMQQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO3/c17-13(18)15(16-9-11-19-12-10-16)7-5-14(6-8-15)3-1-2-4-14/h1-12H2,(H,17,18).
What are the key properties of 8-morpholin-4-ylspiro[4.5]decane-8-carboxylic acid?
8-morpholin-4-ylspiro[4.5]decane-8-carboxylic acid has a molecular weight of 267.37 g/mol, XLogP of 2.28, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-morpholin-4-ylspiro[4.5]decane-8-carboxylic acid is sourced from PubChem (CID 114819765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).