C14H23N3O — CID 114820232
N-(2-methoxyethyl)spiro[1,4,6,7-tetrahydroindazole-5,1'-cyclopentane]-3-amine (PubChem CID 114820232) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is N-(2-methoxyethyl)spiro[1,4,6,7-tetrahydroindazole-5,1'-cyclopentane]-3-amine.
| Compound Name | N-(2-methoxyethyl)spiro[1,4,6,7-tetrahydroindazole-5,1'-cyclopentane]-3-amine |
|---|---|
| PubChem CID | 114820232 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | N-(2-methoxyethyl)spiro[1,4,6,7-tetrahydroindazole-5,1'-cyclopentane]-3-amine |
| SMILES | COCCNc1n[nH]c2c1CC1(CCCC1)CC2 |
| InChI | InChI=1S/C14H23N3O/c1-18-9-8-15-13-11-10-14(5-2-3-6-14)7-4-12(11)16-17-13/h2-10H2,1H3,(H2,15,16,17) |
| InChIKey | AGYPGDWXYGAOEB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|