C16H16F3N — CID 114820912
5,6,7-trifluorospiro[1,2,4,9-tetrahydrocarbazole-3,1'-cyclopentane] (PubChem CID 114820912) has the molecular formula C16H16F3N and a molecular weight of 279.30 g/mol. Its IUPAC name is 5,6,7-trifluorospiro[1,2,4,9-tetrahydrocarbazole-3,1'-cyclopentane].
| Compound Name | 5,6,7-trifluorospiro[1,2,4,9-tetrahydrocarbazole-3,1'-cyclopentane] |
|---|---|
| PubChem CID | 114820912 |
| Molecular Formula | C16H16F3N |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 5,6,7-trifluorospiro[1,2,4,9-tetrahydrocarbazole-3,1'-cyclopentane] |
| SMILES | Fc1cc2[nH]c3c(c2c(F)c1F)CC1(CCCC1)CC3 |
| InChI | InChI=1S/C16H16F3N/c17-10-7-12-13(15(19)14(10)18)9-8-16(4-1-2-5-16)6-3-11(9)20-12/h7,20H,1-6,8H2 |
| InChIKey | ZPLXMZZBZCNBCZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|