C14H12BrClO3 — CID 114822442
6-bromo-7-[chloro-(5-methylfuran-3-yl)methyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 114822442) has the molecular formula C14H12BrClO3 and a molecular weight of 343.60 g/mol. Its IUPAC name is 6-bromo-7-[chloro-(5-methylfuran-3-yl)methyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-bromo-7-[chloro-(5-methylfuran-3-yl)methyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 114822442 |
| Molecular Formula | C14H12BrClO3 |
| Molecular Weight | 343.60 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | 6-bromo-7-[chloro-(5-methylfuran-3-yl)methyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | Cc1cc(C(Cl)c2cc3c(cc2Br)OCCO3)co1 |
| InChI | InChI=1S/C14H12BrClO3/c1-8-4-9(7-19-8)14(16)10-5-12-13(6-11(10)15)18-3-2-17-12/h4-7,14H,2-3H2,1H3 |
| InChIKey | YLEJZYHETZGNGP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.60 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|