C15H17NO3 — CID 11482331
methyl (1R,3S,3aR,6aS)-6-oxo-1-phenyl-2,3,3a,4,5,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate (PubChem CID 11482331) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is methyl (1R,3S,3aR,6aS)-6-oxo-1-phenyl-2,3,3a,4,5,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate.
| Compound Name | methyl (1R,3S,3aR,6aS)-6-oxo-1-phenyl-2,3,3a,4,5,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 11482331 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | methyl (1R,3S,3aR,6aS)-6-oxo-1-phenyl-2,3,3a,4,5,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@H]1N[C@@H](c2ccccc2)[C@H]2C(=O)CC[C@H]21 |
| InChI | InChI=1S/C15H17NO3/c1-19-15(18)14-10-7-8-11(17)12(10)13(16-14)9-5-3-2-4-6-9/h2-6,10,12-14,16H,7-8H2,1H3/t10-,12-,13+,14+/m1/s1 |
| InChIKey | BFJOAXRTNNKELW-ZZVYKPCYSA-N |
| XLogP | 1.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |