C16H25BO2 — CID 11482352
4,4,5,5-tetramethyl-2-(5-methyl-2-prop-1-en-2-ylcyclohexa-1,4-dien-1-yl)-1,3,2-dioxaborolane (PubChem CID 11482352) has the molecular formula C16H25BO2 and a molecular weight of 260.19 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(5-methyl-2-prop-1-en-2-ylcyclohexa-1,4-dien-1-yl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(5-methyl-2-prop-1-en-2-ylcyclohexa-1,4-dien-1-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 11482352 |
| Molecular Formula | C16H25BO2 |
| Molecular Weight | 260.19 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(5-methyl-2-prop-1-en-2-ylcyclohexa-1,4-dien-1-yl)-1,3,2-dioxaborolane |
| SMILES | C=C(C)C1=C(B2OC(C)(C)C(C)(C)O2)CC(C)=CC1 |
| InChI | InChI=1S/C16H25BO2/c1-11(2)13-9-8-12(3)10-14(13)17-18-15(4,5)16(6,7)19-17/h8H,1,9-10H2,2-7H3 |
| InChIKey | YPJYOACQQUWBKU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.19 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|