About 5-amino-2,4-dibromophenol
5-amino-2,4-dibromophenol (PubChem CID 11482526) has the molecular formula C6H5Br2NO
and a molecular weight of 266.92 g/mol. Its IUPAC name is 5-amino-2,4-dibromophenol.
Molecular Properties
| Compound Name | 5-amino-2,4-dibromophenol |
| PubChem CID | 11482526 |
| Molecular Formula | C6H5Br2NO |
| Molecular Weight | 266.92 g/mol |
| Exact Mass | 264.87 |
| IUPAC Name | 5-amino-2,4-dibromophenol |
| SMILES | Nc1cc(O)c(Br)cc1Br |
| InChI | InChI=1S/C6H5Br2NO/c7-3-1-4(8)6(10)2-5(3)9/h1-2,10H,9H2 |
| InChIKey | VTUOVVLBSQTSKX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.92 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2,4-dibromophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2,4-dibromophenol?
The IUPAC name of 5-amino-2,4-dibromophenol (CID 11482526) is 5-amino-2,4-dibromophenol.
What is the SMILES notation for 5-amino-2,4-dibromophenol?
The canonical SMILES for 5-amino-2,4-dibromophenol is Nc1cc(O)c(Br)cc1Br.
What is the InChIKey of 5-amino-2,4-dibromophenol?
The InChIKey is VTUOVVLBSQTSKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Br2NO/c7-3-1-4(8)6(10)2-5(3)9/h1-2,10H,9H2.
What are the key properties of 5-amino-2,4-dibromophenol?
5-amino-2,4-dibromophenol has a molecular weight of 266.92 g/mol, XLogP of 2.50, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2,4-dibromophenol is sourced from PubChem (CID 11482526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).