C17H17NO2 — CID 11482538
naphthalene-2,6-diol;phenylmethanamine (PubChem CID 11482538) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is naphthalene-2,6-diol;phenylmethanamine.
| Compound Name | naphthalene-2,6-diol;phenylmethanamine |
|---|---|
| PubChem CID | 11482538 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | naphthalene-2,6-diol;phenylmethanamine |
| SMILES | NCc1ccccc1.Oc1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C10H8O2.C7H9N/c11-9-3-1-7-5-10(12)4-2-8(7)6-9;8-6-7-4-2-1-3-5-7/h1-6,11-12H;1-5H,6,8H2 |
| InChIKey | YXVMLIABAIZUNP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |