C15H25NO3 — CID 114826243
(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(5-methyloxolan-3-yl)methanone (PubChem CID 114826243) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(5-methyloxolan-3-yl)methanone.
| Compound Name | (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(5-methyloxolan-3-yl)methanone |
|---|---|
| PubChem CID | 114826243 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(5-methyloxolan-3-yl)methanone |
| SMILES | CC1CC(C(=O)N2CCC3(O)CCCCC3C2)CO1 |
| InChI | InChI=1S/C15H25NO3/c1-11-8-12(10-19-11)14(17)16-7-6-15(18)5-3-2-4-13(15)9-16/h11-13,18H,2-10H2,1H3 |
| InChIKey | VXDFLFWLDBLUPY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |