C16H19FN2O2 — CID 114826624
N-[[5-(3-aminoprop-1-ynyl)-2-fluorophenyl]methyl]-5-methyloxolane-3-carboxamide (PubChem CID 114826624) has the molecular formula C16H19FN2O2 and a molecular weight of 290.34 g/mol. Its IUPAC name is N-[[5-(3-aminoprop-1-ynyl)-2-fluorophenyl]methyl]-5-methyloxolane-3-carboxamide.
| Compound Name | N-[[5-(3-aminoprop-1-ynyl)-2-fluorophenyl]methyl]-5-methyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 114826624 |
| Molecular Formula | C16H19FN2O2 |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-[[5-(3-aminoprop-1-ynyl)-2-fluorophenyl]methyl]-5-methyloxolane-3-carboxamide |
| SMILES | CC1CC(C(=O)NCc2cc(C#CCN)ccc2F)CO1 |
| InChI | InChI=1S/C16H19FN2O2/c1-11-7-14(10-21-11)16(20)19-9-13-8-12(3-2-6-18)4-5-15(13)17/h4-5,8,11,14H,6-7,9-10,18H2,1H3,(H,19,20) |
| InChIKey | KCWQNWAUMHVBIM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|