C12H15ClO2 — CID 114826660
(4-chlorophenyl)-(5-methyloxolan-3-yl)methanol (PubChem CID 114826660) has the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. Its IUPAC name is (4-chlorophenyl)-(5-methyloxolan-3-yl)methanol.
| Compound Name | (4-chlorophenyl)-(5-methyloxolan-3-yl)methanol |
|---|---|
| PubChem CID | 114826660 |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.70 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (4-chlorophenyl)-(5-methyloxolan-3-yl)methanol |
| SMILES | CC1CC(C(O)c2ccc(Cl)cc2)CO1 |
| InChI | InChI=1S/C12H15ClO2/c1-8-6-10(7-15-8)12(14)9-2-4-11(13)5-3-9/h2-5,8,10,12,14H,6-7H2,1H3 |
| InChIKey | AZDRBCMWNVCQML-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.70 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |