C9H7FINOS — CID 114827337
8-fluoro-7-iodo-3,5-dihydro-2H-1,5-benzothiazepin-4-one (PubChem CID 114827337) has the molecular formula C9H7FINOS and a molecular weight of 323.13 g/mol. Its IUPAC name is 8-fluoro-7-iodo-3,5-dihydro-2H-1,5-benzothiazepin-4-one.
| Compound Name | 8-fluoro-7-iodo-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 114827337 |
| Molecular Formula | C9H7FINOS |
| Molecular Weight | 323.13 g/mol |
| Exact Mass | 322.93 |
| IUPAC Name | 8-fluoro-7-iodo-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
| SMILES | O=C1CCSc2cc(F)c(I)cc2N1 |
| InChI | InChI=1S/C9H7FINOS/c10-5-3-8-7(4-6(5)11)12-9(13)1-2-14-8/h3-4H,1-2H2,(H,12,13) |
| InChIKey | HOCCHIKYXDXNKF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.13 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|