About 8-fluoro-7-iodo-3,5-dihydro-2H-1,5-benzothiazepin-4-one
8-fluoro-7-iodo-3,5-dihydro-2H-1,5-benzothiazepin-4-one (PubChem CID 114827337) has the molecular formula C9H7FINOS
and a molecular weight of 323.13 g/mol. Its IUPAC name is 8-fluoro-7-iodo-3,5-dihydro-2H-1,5-benzothiazepin-4-one.
Molecular Properties
| Compound Name | 8-fluoro-7-iodo-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
| PubChem CID | 114827337 |
| Molecular Formula | C9H7FINOS |
| Molecular Weight | 323.13 g/mol |
| Exact Mass | 322.93 |
| IUPAC Name | 8-fluoro-7-iodo-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
| SMILES | O=C1CCSc2cc(F)c(I)cc2N1 |
| InChI | InChI=1S/C9H7FINOS/c10-5-3-8-7(4-6(5)11)12-9(13)1-2-14-8/h3-4H,1-2H2,(H,12,13) |
| InChIKey | HOCCHIKYXDXNKF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.13 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 8-fluoro-7-iodo-3,5-dihydro-2H-1,5-benzothiazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-7-iodo-3,5-dihydro-2H-1,5-benzothiazepin-4-one?
The IUPAC name of 8-fluoro-7-iodo-3,5-dihydro-2H-1,5-benzothiazepin-4-one (CID 114827337) is 8-fluoro-7-iodo-3,5-dihydro-2H-1,5-benzothiazepin-4-one.
What is the SMILES notation for 8-fluoro-7-iodo-3,5-dihydro-2H-1,5-benzothiazepin-4-one?
The canonical SMILES for 8-fluoro-7-iodo-3,5-dihydro-2H-1,5-benzothiazepin-4-one is O=C1CCSc2cc(F)c(I)cc2N1.
What is the InChIKey of 8-fluoro-7-iodo-3,5-dihydro-2H-1,5-benzothiazepin-4-one?
The InChIKey is HOCCHIKYXDXNKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FINOS/c10-5-3-8-7(4-6(5)11)12-9(13)1-2-14-8/h3-4H,1-2H2,(H,12,13).
What are the key properties of 8-fluoro-7-iodo-3,5-dihydro-2H-1,5-benzothiazepin-4-one?
8-fluoro-7-iodo-3,5-dihydro-2H-1,5-benzothiazepin-4-one has a molecular weight of 323.13 g/mol, XLogP of 2.86, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-7-iodo-3,5-dihydro-2H-1,5-benzothiazepin-4-one is sourced from PubChem (CID 114827337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).