C17H16F2N2 — CID 114828910
3-fluoro-5-[1-(3-fluorophenyl)propan-2-ylamino]-4-methylbenzonitrile (PubChem CID 114828910) has the molecular formula C17H16F2N2 and a molecular weight of 286.32 g/mol. Its IUPAC name is 3-fluoro-5-[1-(3-fluorophenyl)propan-2-ylamino]-4-methylbenzonitrile.
| Compound Name | 3-fluoro-5-[1-(3-fluorophenyl)propan-2-ylamino]-4-methylbenzonitrile |
|---|---|
| PubChem CID | 114828910 |
| Molecular Formula | C17H16F2N2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 3-fluoro-5-[1-(3-fluorophenyl)propan-2-ylamino]-4-methylbenzonitrile |
| SMILES | Cc1c(F)cc(C#N)cc1NC(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C17H16F2N2/c1-11(6-13-4-3-5-15(18)7-13)21-17-9-14(10-20)8-16(19)12(17)2/h3-5,7-9,11,21H,6H2,1-2H3 |
| InChIKey | BBVQGOMKUKVOIQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |