About 1-amino-3-ethoxy-2,2-dimethyl-N-(3-methylsulfanylpropyl)cyclobutane-1-carboxamide
1-amino-3-ethoxy-2,2-dimethyl-N-(3-methylsulfanylpropyl)cyclobutane-1-carboxamide (PubChem CID 114829308) has the molecular formula C13H26N2O2S
and a molecular weight of 274.43 g/mol. Its IUPAC name is 1-amino-3-ethoxy-2,2-dimethyl-N-(3-methylsulfanylpropyl)cyclobutane-1-carboxamide.
Molecular Properties
| Compound Name | 1-amino-3-ethoxy-2,2-dimethyl-N-(3-methylsulfanylpropyl)cyclobutane-1-carboxamide |
| PubChem CID | 114829308 |
| Molecular Formula | C13H26N2O2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-amino-3-ethoxy-2,2-dimethyl-N-(3-methylsulfanylpropyl)cyclobutane-1-carboxamide |
| SMILES | CCOC1CC(N)(C(=O)NCCCSC)C1(C)C |
| InChI | InChI=1S/C13H26N2O2S/c1-5-17-10-9-13(14,12(10,2)3)11(16)15-7-6-8-18-4/h10H,5-9,14H2,1-4H3,(H,15,16) |
| InChIKey | FWVIACAOWHCNKH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-ethoxy-2,2-dimethyl-N-(3-methylsulfanylpropyl)cyclobutane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-ethoxy-2,2-dimethyl-N-(3-methylsulfanylpropyl)cyclobutane-1-carboxamide?
The IUPAC name of 1-amino-3-ethoxy-2,2-dimethyl-N-(3-methylsulfanylpropyl)cyclobutane-1-carboxamide (CID 114829308) is 1-amino-3-ethoxy-2,2-dimethyl-N-(3-methylsulfanylpropyl)cyclobutane-1-carboxamide.
What is the SMILES notation for 1-amino-3-ethoxy-2,2-dimethyl-N-(3-methylsulfanylpropyl)cyclobutane-1-carboxamide?
The canonical SMILES for 1-amino-3-ethoxy-2,2-dimethyl-N-(3-methylsulfanylpropyl)cyclobutane-1-carboxamide is CCOC1CC(N)(C(=O)NCCCSC)C1(C)C.
What is the InChIKey of 1-amino-3-ethoxy-2,2-dimethyl-N-(3-methylsulfanylpropyl)cyclobutane-1-carboxamide?
The InChIKey is FWVIACAOWHCNKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O2S/c1-5-17-10-9-13(14,12(10,2)3)11(16)15-7-6-8-18-4/h10H,5-9,14H2,1-4H3,(H,15,16).
What are the key properties of 1-amino-3-ethoxy-2,2-dimethyl-N-(3-methylsulfanylpropyl)cyclobutane-1-carboxamide?
1-amino-3-ethoxy-2,2-dimethyl-N-(3-methylsulfanylpropyl)cyclobutane-1-carboxamide has a molecular weight of 274.43 g/mol, XLogP of 1.39, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-ethoxy-2,2-dimethyl-N-(3-methylsulfanylpropyl)cyclobutane-1-carboxamide is sourced from PubChem (CID 114829308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).